| Identification | |
| Name: | 9-Bromophenanthrene |
| Synonyms: | 9-Phenanthryl bromide;NSC 400708; |
| CAS: | 573-17-1 |
| EINECS: | 209-351-6 |
| Molecular Formula: | C14H9Br |
| Molecular Weight: | 257.12526 |
| InChI: | InChI=1S/C14H9Br/c15-14-9-10-5-1-2-6-11(10)12-7-3-4-8-13(12)14/h1-9H |
| Molecular Structure: |  |
| Properties | |
| Transport: | 25kgs |
| Density: | 1.479g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.6799 (100.7 C) |
| Water Solubility: | AUTOIGNITION |
| Solubility: | AUTOIGNITION |
| Appearance: | yellow cystalline powder |
| Specification: |
9-Bromophenanthrene , its CAS NO. is 573-17-1, the synonyms are 9-Phenathryl bromide ; Phenanthrene, 9-bromo- . |
| HS Code: | 29036990 |
| Storage Temperature: | Store in a cool, dry place. Store in a tightly closed container. |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
Xi: Irritant
|
 |
|
