Identification |
Name: | sodium; ethenyl acetate; prop-2-enoate |
Synonyms: | 2-Propenoic acid, polymer with ethenyl acetate, sodium salt;2-Propenoic acid, sodium salt, polymer with ethenyl acetate;2-Propenoic acid, sodium salt (1:1), polymer with ethenyl acetate;57649-87-3;58931-94-5 |
CAS: | 57649-87-3 |
Molecular Formula: | C7H9NaO4 |
Molecular Weight: | 180.1337 |
InChI: | InChI=1S/C4H6O2.C3H4O2.Na/c1-3-6-4(2)5;1-2-3(4)5;/h3H,1H2,2H3;2H,1H2,(H,4,5);/q;;+1/p-1 |
Molecular Structure: |
|
Properties |
Flash Point: | 72.5°Cat760mmHg |
Boiling Point: | 72.5°Cat760mmHg |
Density: | g/cm3 |
Flash Point: | 72.5°Cat760mmHg |
Safety Data |
|
|