| Identification |
| Name: | sodium prop-2-enoate - ethenyl acetate (1:1) |
| Synonyms: | 2-Propenoic acid, polymer with ethenyl acetate, sodium salt;2-Propenoic acid, sodium salt, polymer with ethenyl acetate;2-Propenoic acid, sodium salt (1:1), polymer with ethenyl acetate;57649-87-3;58931-94-5 |
| CAS: | 57649-87-3;58931-94-5 |
| Molecular Formula: | C7H9NaO4 |
| Molecular Weight: | 180.1337 |
| InChI: | InChI=1/C4H6O2.C3H4O2.Na/c1-3-6-4(2)5;1-2-3(4)5;/h3H,1H2,2H3;2H,1H2,(H,4,5);/q;;+1/p-1 |
| Molecular Structure: |
 |
| Properties |
| Boiling Point: | 72.5°C at 760 mmHg |
| Safety Data |
| |
 |
