| Identification | |
| Name: | Benzene,1-methoxy-2-methyl- |
| Synonyms: | 2-Cresol methyl ether;2-Methoxytoluene;2-Methyl-1-methoxybenzene;Methyl o-cresylether;Methyl o-methylphenyl ether;Methyl o-tolyl ether;NSC 6253;o-Cresolmethyl ether;o-Methoxytoluene;o-Methylanisole;Anisole,o-methyl- (8CI);1-Methoxy-2-methylbenzene; |
| CAS: | 578-58-5 |
| EINECS: | 209-426-3 |
| Molecular Formula: | C8H10O |
| Molecular Weight: | 122.17 |
| InChI: | InChI=1/C8H10O/c1-7-5-3-4-6-8(7)9-2/h3-6H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1993 |
| Density: | 0.985 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.516-1.518 |
| Water Solubility: | immiscible |
| Solubility: | immiscible |
| Appearance: | Colorless liquid. |
| Specification: |
2-Methylanisole (578-58-5) is hazardous,so the first aid measures and others should be known .Such as: When on the skin: first,should flush skin with plenty of water immediatelyfor at least 15 minutes while removing contaminated clothing and .Secondly,Get shoesmedical aid . Or in the eyes: Flush eyes with plenty of soap and water.Then get medical aid soon.While ,it's Inhaled: Remove from exposure and move to fresh air immediately. And as soon as to get medical aid.Then you have the ingesting of the product : Wash mouth out with water,and get medical aid immediately.And as known its polymerization is hazardous. |
| Packinggroup: | III |
| HS Code: | 29093090 |
| Storage Temperature: | Flammables area |
| Safety Data | |
 |
|
