| Identification | |
| Name: | ethyl diazoacetate |
| Synonyms: | - |
| CAS: | 623-73-4 |
| EINECS: | 210-810-8 |
| Molecular Formula: | C4H6N2O2 |
| Molecular Weight: | 114.1 |
| InChI: | InChI=1/C4H6N2O2/c1-2-8-4(7)3-6-5/h3H,2H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1993 |
| Density: | 1.085 |
| Refractive index: | 1.46 |
| Solubility: | insoluble in water, soluble in organic solvents such as dichloroethane |
| Appearance: | colourless liquid |
| Specification: |
Diazoacetic ester ,its cas register number is 623-73-4. It also can be called Ethyl 2-diazoacetate ; Acetic acid, diazo-, ethyl ester ; and Ethyl diazoacetate . |
| Packinggroup: | III |
| Storage Temperature: | 2-8°C |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
