| Identification | |
| Name: | Dimethyl Maleate |
| Synonyms: | 2-Butenedioic acid,dimethyl ester; Dimethylester kyseliny maleinove; Dimethyl cis-butenedioate:2-Butenedioic acid (Z)-, dimethyl ester; maleic acid dimethyl ester |
| CAS: | 624-48-6 |
| EINECS: | 210-848-5 |
| Molecular Formula: | C6H8O4 |
| Molecular Weight: | 144.12532 |
| InChI: | InChI=1S/C6H8O4/c1-9-5(7)3-4-6(8)10-2/h3-4H,1-2H3/b4-3+ |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2810 |
| Melting Point: | -17 C |
| Density: | 1.152 |
| Stability: | Stable. Combustible. Incompatible with acids, bases, reducing agents, strong oxidizing agents. |
| Refractive index: | 1.441-1.443 |
| Water Solubility: | slightly soluble |
| Solubility: | slightly
soluble
|
| Appearance: | clear liquid |
| Specification: | colourless liquid Safety Statements:26-36/37-23 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37:Wear suitable protective clothing and gloves 23:Do not breathe gas/fumes/vapor/spray (appropriate wording to be specified by the manufacturer) |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| HS Code: | 29171990 |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Color: | Crystals |
| Usage: | Improves the hardness and toughness of polymer films. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
