| Identification | |
| Name: | Dibutyl maleate |
| Synonyms: | (Z)-2-Butenedioic acid dibutyl ester; |
| CAS: | 105-76-0 |
| EINECS: | 203-328-4 |
| Molecular Formula: | C12H20O4 |
| Molecular Weight: | 228.29 |
| InChI: | InChI=1/C12H20O4/c1-3-5-9-15-11(13)7-8-12(14)16-10-6-4-2/h7-8H,3-6,9-10H2,1-2H3/b8-7- |
| Molecular Structure: |  |
| Properties | |
| Density: | 0.988 |
| Stability: | No data. |
| Refractive index: | 1.444-1.446 |
| Water Solubility: | insoluble |
| Solubility: | Insoluble in water |
| Appearance: | clear colourless to slightly yellowish liquid |
| Specification: |
General Information: As in any fire, wear a self-contained breathing apparatus in pressure-demand, MSHA/NIOSH (approved or equivalent), and full protective gear. |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | I; II; III |
| HS Code: | 29171990 |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. Flammables-area. Refrigerator (approx 4 C). |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
