| Identification |
| Name: | Flupirtine maleate |
| Synonyms: | (2-Amino-6-(((4-fluorophenyl)methyl)amino)-3-pyridinyl)carbamic acid ethyl ester maleate;Carbamic acid, (2-amino-6-(((4-fluorophenyl)methyl)amino)-3-pyridinyl)-, ethyl ester, (Z)-2-butenedioate (1:1);D-9998;Ethyl 2-amino-6-((p-fluorobenzyl)amino)-3-pyridinecarbamate maleate (1:1);Flupirtin-maleat;UNII-0VCI53PK4A;W 2964M; |
| CAS: | 75507-68-5 |
| EINECS: | 278-225-0 |
| Molecular Formula: | C15H17FN4O2.C4H4O4 |
| Molecular Weight: | 420.391643 |
| InChI: | InChI=1S/C15H17FN4O2.C4H4O4/c1-2-22-15(21)19-12-7-8-13(20-14(12)17)18-9-10-3-5-11(16)6-4-10;5-3(6)1-2-4(7)8/h3-8H,2,9H2,1H3,(H,19,21)(H3,17,18,20);1-2H,(H,5,6)(H,7,8)/b;2-1- |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.35 g/cm3 |
| Water Solubility: | Soluble to 100 mM in DMSO and to 10 mM in Ethanol |
| Solubility: | Soluble to 100 mM in DMSO and to 10 mM in Ethanol |
| Appearance: | off-white Crystalline powder |
| Biological Activity: | Non-opioid analgesic with muscle relaxant properties. Activates K + channels and indirectly antagonizes NMDA receptors. Exhibits neuroprotective actions in a model of cerebral ischemia in mice and reduces apoptosis and necrosis induced by noxious stimuli. |
| Usage: | Analgesic. Substituted pyridine with central analgesic properties. |
| Safety Data |
| |
 |
