| Identification |
| Name: | Tyrosine, 3,5-diiodo- |
| Synonyms: | 3,5-Diiodo-4-hydroxyphenylalanine;3,5-Diiodotyrosine;Agontan;Apothyrin;Cemiod;DIT;DL-3,5-Diiodotyrosine;Dityrin;Flaianina;Gorgoic acid, diiodo-;Gorgonic acid, diiodo-;Iodogorgoicacid;Iodogorgonic acid;Itir;Jodgorgon;NSC 208959;NSC 97936;b-(4-Hydroxy-3,5-diiodophenyl)alanine; |
| CAS: | 66-02-4 |
| EINECS: | 200-620-3 |
| Molecular Formula: | C9H9I2NO3 |
| Molecular Weight: | 432.98 |
| InChI: | InChI=1S/C9H9I2NO3/c10-5-1-4(2-6(11)8(5)13)3-7(12)9(14)15/h1-2,7,13H,3,12H2,(H,14,15) |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 87 |
| Boiling Point: | 200 |
| Density: | 0.89 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.5025 (20 C) |
| Solubility: | Very soluble |
| Appearance: | Clear slightly yellow liquid. |
| HS Code: | 29214980 |
| Flash Point: | 87 |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| |
 |
