| Identification | |
| Name: | 2-Nitrotoluene |
| Synonyms: | 1-Methyl-2-nitrobenzene; Ortho Nitrotoluene; o-Nitrotoluene |
| CAS: | 88-72-2 |
| EINECS: | 201-853-3 |
| Molecular Formula: | C7H7NO2 |
| Molecular Weight: | 137.14 |
| InChI: | InChI=1/C7H7NO2/c1-6-4-2-3-5-7(6)8(9)10/h2-5H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1664 |
| Density: | 1.163 |
| Stability: | Stable. Combustible. Incompatible with oxidizing agents, strong bases, sulfuric acid, reducing agents, hydrogen, sodium. |
| Refractive index: | 1.5445-1.5465 |
| Solubility: | 0.44 g/L (20 ºC) |
| Appearance: | light yellow to darker yellow-green liquid |
| Packinggroup: | II |
| HS Code: | 29042000 |
| Storage Temperature: | 2-8°C |
| Color: | Yellowish liquid at ordinary temperature Yellow liquid. [Note: A solid below 25 degrees F.] |
| Usage: | For production of toluidine, tolidine, fuchsine, and various synthetic dyes. |
| Safety Data | |
| Hazard Symbols |
T:Toxic
N:Dangerousfortheenvironment
|
 |
|
