| Identification | |
| Name: | Phenol,2-fluoro-3-methyl- |
| Synonyms: | 2-Fluoro-m-cresol; |
| CAS: | 77772-72-6 |
| Molecular Formula: | C7H7FO |
| Molecular Weight: | 126.13 |
| InChI: | InChI=1/C7H7FO/c1-5-3-2-4-6(9)7(5)8/h2-4,9H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 67.386°C |
| Boiling Point: | 174.199°C at 760 mmHg |
| Density: | 1.164g/cm3 |
| Refractive index: | 1.52 |
| Specification: |
2-Fluoro-3-methylphenol , with CAS number of 77772-72-6, can be called 2-Fluor-3-methylbenzolol ; 2-Fluoro-3-methylphenol ; 2-Fluoro-m-cresol ; phenol, 2-fluoro-3-methyl- . |
| Flash Point: | 67.386°C |
| Storage Temperature: | Room temperature. |
| Safety Data | |
 |
|
