| Identification | |
| Name: | Phenol,4-fluoro-3-methyl- |
| Synonyms: | m-Cresol,4-fluoro- (6CI,8CI);2-Fluoro-5-hydroxytoluene;3-Methyl-4-fluorophenol;4-Fluoro-m-cresol; |
| CAS: | 452-70-0 |
| Molecular Formula: | C7H7FO |
| Molecular Weight: | 126.13 |
| InChI: | InChI=1S/C7H7FO/c1-5-4-6(9)2-3-7(5)8/h2-4,9H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 1759 |
| Density: | 1.134 |
| Refractive index: | 1.515 |
| Specification: | Safety Statements:26-37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
