| Identification | |
| Name: | Phenol,3-fluoro-4-methyl- |
| Synonyms: | p-Cresol,3-fluoro- (6CI,8CI);3-Fluoro-4-cresol; |
| CAS: | 452-78-8 |
| Molecular Formula: | C7H7FO |
| Molecular Weight: | 126.13 |
| InChI: | InChI=1/C7H7FO/c1-5-2-3-6(9)4-7(5)8/h2-4,9H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2922 |
| Flash Point: | 83.6°C |
| Boiling Point: | 194.2°Cat760mmHg |
| Density: | 1.164g/cm3 |
| Refractive index: | 1.52 |
| Specification: | Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Flash Point: | 83.6°C |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
