| Identification | |
| Name: | DL-Threonine |
| Synonyms: | Threonine, DL- (8CI);Threonine;NSC206292; |
| CAS: | 80-68-2 |
| EINECS: | 201-300-6 |
| Molecular Formula: | C4H9NO3 |
| Molecular Weight: | 119.12 |
| InChI: | InChI=1/C4H9NO3/c1-2(6)3(5)4(7)8/h2-3,6H,5H2,1H3,(H,7,8) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 162.9°C |
| Boiling Point: | 345.8°C at 760 mmHg |
| Density: | 1.307g/cm3 |
| Refractive index: | 1.507 |
| Solubility: | 200 g/L (25 oC) |
| Appearance: | white crystalline powder |
| Specification: | White crystalline powder Safety Statements:24/25-37/39-26 24/25:Avoid contact with skin and eyes 37/39:Wear suitable protective clothing, gloves and eye/face protection 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice |
| HS Code: | 29225000 |
| Flash Point: | 162.9°C |
| Storage Temperature: | Store at RT. |
| Color: | Colorless crystals Crystals |
| Safety Data | |
 |
|
