| Identification | |
| Name: | Piperazine,1-(2,3-dimethylphenyl)-, hydrochloride (1:?) |
| Synonyms: | Piperazine,1-(2,3-dimethylphenyl)-, hydrochloride (6CI,9CI) |
| CAS: | 80836-96-0 |
| Molecular Formula: | C12H18 N2 . x Cl H |
| Molecular Weight: | 226.75 |
| InChI: | InChI=1/C12H18N2.ClH/c1-10-4-3-5-12(11(10)2)14-8-6-13-7-9-14;/h3-5,13H,6-9H2,1-2H3;1H |
| Molecular Structure: |  |
| Properties | |
| Density: | 0.999g/cm3 |
| Refractive index: | 1.537 |
| Specification: |
1-(2,3-Xylyl)piperazine monohydrochloride , with CAS number of 80836-96-0, can be called piperazine, 1-(2,3-dimethylphenyl)-, hydrochloride (1:1) ; 1-(2,3-Dimethylphenyl)piperazinhydrochlorid ; 1-(2,3-Xylyl)piperazine monohydrochloride . |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
