| Identification |
| Name: | 2-Picoline-N-oxide |
| Synonyms: | 2-Picoline N-oxide; 2-Methylpyridine N-oxide; PicolineNoxide |
| CAS: | 931-19-1 |
| EINECS: | 213-230-3 |
| Molecular Formula: | C6H7NO |
| Molecular Weight: | 109.13 |
| InChI: | InChI=1/C6H7NO/c1-6-4-2-3-5-7(6)8/h2-5H,1H3 |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.01g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. Hygroscopic: absorbs moisture or water from the air. |
| Refractive index: | 1.5895 (20 C) |
| Water Solubility: | soluble |
| Solubility: | soluble |
| Appearance: | Brown crystalline powder. |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. Store protected from moisture. |
| Sensitive: | Hygroscopic |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
