| Identification |
| Name: | ethyl prop-2-enoate; [(E)-3-methoxy-2-methyl-3-oxo-prop-1-enyl]ammonium; 2-methylprop-2-enoic acid |
| Synonyms: | AC1MI2GE;Methyl methacrylate, methacrylic acid, ethyl acrylate polymer, ammonium salt;2-Propenoic acid, 2-methyl-, polymer with ethyl 2-propenoate and methyl 2-methyl-2-propenoate, ammonium salt;55989-05-4;62008-85-9;ethyl prop-2-enoate; [(E)-3-methoxy-2-methyl-3-oxoprop-1-enyl]azanium; 2-methylprop-2-enoic acid |
| CAS: | 55989-05-4;62008-85-9 |
| Molecular Formula: | C14H24NO6 |
| Molecular Weight: | 302.3429 |
| InChI: | InChI=1/C5H9NO2.C5H8O2.C4H6O2/c1-4(3-6)5(7)8-2;1-3-5(6)7-4-2;1-3(2)4(5)6/h3H,6H2,1-2H3;3H,1,4H2,2H3;1H2,2H3,(H,5,6)/p+1/b4-3+;; |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 65.3°C |
| Boiling Point: | 194.1°C at 760 mmHg |
| Flash Point: | 65.3°C |
| Safety Data |
| |
 |