| Identification | |
| Name: | Diphenyl carbonate |
| Synonyms: | Diphenylcarbonate;NSC 37087;Phenyl carbonate;Phenyl carbonate ((PhO)2CO);Carbonic acid, diphenyl ester; |
| CAS: | 102-09-0 |
| EINECS: | 203-005-8 |
| Molecular Formula: | C13H10O3 |
| Molecular Weight: | 214.22 |
| InChI: | InChI=1/C13H10O3/c14-13(15-11-7-3-1-4-8-11)16-12-9-5-2-6-10-12/h1-10H |
| Molecular Structure: |  |
| Properties | |
| Transport: | 25kgs |
| Density: | 1.3 |
| Stability: | Stable. Incompatible with strong oxidizing agents. Flammable. |
| Refractive index: | 1.575 |
| Water Solubility: | Insoluble |
| Solubility: | insoluble |
| Appearance: | white crystalline solid |
| Specification: | white solid Safety Statements:22-24/25 22:Do not breathe dust 24/25:Avoid contact with skin and eyes |
| Report: |
Reported in EPA TSCA Inventory. |
| HS Code: | 29209010 |
| Storage Temperature: | Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Color: | Lustrous needles WHITE, CRYSTALLINE SOLID |
| Usage: | In molten state as solvent for nitrocellulose. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
