| Identification | |
| Name: | Potassium carbonate |
| Synonyms: | Potassium carbonate anhydrous; Potassium carbonate hemihydrate; PotassiumcarbonateACSwhitepowder; Dipotassium carbonate; Carbonic acid, dipotassium salt; Carbonate Of Potash; Salt of tartar; alt of wormwood; Pearl ash; Potash |
| CAS: | 584-08-7 |
| EINECS: | 209-529-3 |
| Molecular Formula: | K2CO3 |
| Molecular Weight: | 138.19 |
| InChI: | InChI=1/CH2O3.2K/c2-1(3)4;;/h(H2,2,3,4);;/q;2*+1/p-2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 3262 |
| Density: | 2.43 |
| Stability: | Stable. Incompatible with moisture, acids, magnesium bromine trifluoride and magnesium bromine trichloride. |
| Solubility: | 1120 g/L (20 oC) |
| Appearance: | white powder or granules |
| Specification: |
Potassium carbonate , its CAS NO. is 584-08-7, the synonyms are Carbonic acid, dipotassium salt ; Dipotassium carbonate . |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| HS Code: | 28364000 |
| Storage Temperature: | Store at RT. |
| Sensitive: | Hygroscopic |
| Color: | Granules or granular powder White monoclinic crystals |
| Usage: | Ph adjustment, fungicide, microbiocide, herbicide. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
