| Identification | |
| Name: | Ammonium carbonate |
| Synonyms: | - |
| CAS: | 506-87-6 |
| EINECS: | 208-058-0 |
| Molecular Formula: | (NH4)2?CO3 |
| Molecular Weight: | 96.08 |
| InChI: | InChI=1/CH2O3.2H3N/c2-1(3)4;;/h(H2,2,3,4);2*1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 9084 |
| Density: | 2.7 (vs air) |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. May decompose on exposure to air. |
| Water Solubility: | SOLUBLE |
| Appearance: | white powder |
| Storage Temperature: | Store at RT. |
| Sensitive: | Hygroscopic |
| Color: | Colorless, hard, translucent, crystal masses, white cubes or powder |
| Usage: | In baking powders, for washing and defatting woolens, tanning, as mordant in dyeing, in manufacture of rubber articles, casein glue, casein colors, in fire extinguishers, for separating cocas constituents, as a reagent in analytical chemistry. |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
|
 |
|
