| Identification | |
| Name: | Diethyl carbonate |
| Synonyms: | Ethyl carbonate; Carbonic acid diethyl ester |
| CAS: | 105-58-8 |
| EINECS: | 203-311-1 |
| Molecular Formula: | C5H10O3 |
| Molecular Weight: | 118.13 |
| InChI: | InChI=1/C5H10O3/c1-3-7-5(6)8-4-2/h3-4H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2366 |
| Density: | 0.975 |
| Stability: | Stable. Flammable. Incompatible with strong acids, strong bases, reducing agents, oxidizing agents. Protect from moisture. |
| Refractive index: | 1.383-1.385 |
| Water Solubility: | Negligible |
| Solubility: | Negligible |
| Appearance: | colourless liquid with a mild odour |
| Specification: | colourless liquid with a mild odour Safety Statements:26-36-45-16-23 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) 16:Keep away from sources of ignition - No smoking 23:Do not breathe gas/fumes/vapor/spray (appropriate wording to be specified by the manufacturer) |
| Packinggroup: | III |
| Storage Temperature: | Flammables area |
| Sensitive: | Moisture Sensitive |
| Color: | Colorless liquid |
| Safety Data | |
| Hazard Symbols | |
 |
|
