| Identification | |
| Name: | METHOXYPROMAZINE MALEATE |
| Synonyms: | 10-[3-(dimethylammonio)propyl]-2-methoxy-10H-phenothiazinium maleate |
| CAS: | 3403-42-7 |
| EINECS: | 222-277-9 |
| Molecular Formula: | C18H22N2OS . C4H4O4 |
| Molecular Weight: | 430.56 |
| InChI: | InChI=1/C18H22N2OS.C4H4O4/c1-19(2)11-6-12-20-15-7-4-5-8-17(15)22-18-10-9-14(21-3)13-16(18)20;5-3(6)1-2-4(7)8/h4-5,7-10,13H,6,11-12H2,1-3H3;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| Molecular Structure: | ![(C18H22N2OS.C4H4O4) 10-[3-(dimethylammonio)propyl]-2-methoxy-10H-phenothiazinium maleate](https://img.guidechem.com/cas/gif/3403-42-7.gif) |
| Properties | |
| Flash Point: | 233.1°C |
| Boiling Point: | 461.8°Cat760mmHg |
| Density: | g/cm3 |
| Specification: |
Methoxypromazine maleate , its cas register number is 3403-42-7. It also can be called 10-(3-(Dimethylamino)propyl)-2-methoxyphenothiazine maleate ; 2-Methoxypromazine maleate ; Methopromazine maleate ; Metopromazine maleate ; Mopazine ; Mopazine maleate ; and Tentone maleate . |
| Flash Point: | 233.1°C |
| Safety Data | |
 |
|
