| Identification |
| Name: | Phenyl salicylate |
| Synonyms: | Benzoic acid,2-hydroxy-,esters,phenyl ester;Benzoic acid, 2-hydroxy-, phenyl ester;2-Hydroxybenzoic acid, phenyl ester;Phenyl-2-hydroxybenzoate;Fenylester kyseliny salicylove;Phenylsalicylate;2-Phenoxycarbonylphenol;Phenol salicylate;Musol;Salicylic acid, phenyl ester;Salphenyl;Fenylester kyseliny salicylove [Czech]; |
| CAS: | 118-55-8 |
| EINECS: | 204-259-2 |
| Molecular Formula: | C13H10O3 |
| Molecular Weight: | 214.22 |
| InChI: | InChI=1/C13H10O3/c14-12-9-5-4-8-11(12)13(15)16-10-6-2-1-3-7-10/h1-9,14H |
| Molecular Structure: |
 |
| Properties |
| Transport: | 25kgs
|
| Flash Point: | 137.3 ºC |
| Density: | 1.25 g/cm3 |
| Stability: | Light sensitive. Incompatible with strong oxidants. Flammable. |
| Refractive index: | 1.615 |
| Water Solubility: | Insoluble |
| Solubility: | Insoluble
|
| Appearance: | white
crystalline powder |
| Flash Point: | 137.3 ºC |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Usage: | Substance is used in the production of various polymers for the plastics industry, also in lacquers, adhesives, waxes, polishes. |
| Safety Data |
| Hazard Symbols |
|
| |
 |
