| Identification | |
| Name: | Heptyl salicylate |
| Synonyms: | Salicylicacid, heptyl ester (6CI,7CI,8CI);benzoic acid, 2-hydroxy-, heptyl ester;heptyl 2-hydroxybenzoate; |
| CAS: | 6259-77-4 |
| EINECS: | 228-409-1 |
| Molecular Formula: | C14H20O3 |
| Molecular Weight: | 236.3068 |
| InChI: | InChI=1/C14H20O3/c1-2-3-4-5-8-11-17-14(16)12-9-6-7-10-13(12)15/h6-7,9-10,15H,2-5,8,11H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.051 g/cm3 |
| Refractive index: | 1.514 |
| Specification: |
Heptyl salicylate , with CAS number is 20843-07-6, can be called Salicylicacid, heptyl ester (6CI,7CI,8CI) ; benzoic acid, 2-hydroxy-, heptyl ester ; heptyl 2-hydroxybenzoate . |
| Safety Data | |
 |
|
