| Identification | |
| Name: | Benzyl salicylate |
| Synonyms: | Salicylicacid, benzyl ester (6CI,7CI,8CI);Benzyl 2-hydroxybenzoate;Benzyl o-hydroxybenzoate;NSC 6647; |
| CAS: | 118-58-1 |
| EINECS: | 204-262-9 |
| Molecular Formula: | C14H12O3 |
| Molecular Weight: | 228.25 |
| InChI: | InChI=1/C14H12O3/c15-13-9-5-4-8-12(13)14(16)17-10-11-6-2-1-3-7-11/h1-9,15H,10H2 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.175 |
| Stability: | No data. |
| Refractive index: | 1.5804-1.582 |
| Water Solubility: | Slightly soluble |
| Solubility: | Slightly soluble in water |
| Appearance: | almost colorless liquid |
| Specification: |
?Benzyl salicylate , its CAS NO. is 118-58-1, the synonyms are 2-Hydroxybenzoic acid phenylmethyl ester ; Benzyl o-hydroxybenzoate; Salicylic acid benzyl ester . |
| Report: |
Reported in EPA TSCA Inventory. |
| Storage Temperature: | Keep in a cool, dry, dark location in a tightly sealed container or cylinder. Keep away from incompatible materials, ignition sources and untrained individuals. Secure and label area. Protect containers/cylinders from physical damage. |
| Usage: | Used as a fixer in as an aroma for perfumes. |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
