| Identification | |
| Name: | ANTIPYRINE SALICYLATE |
| Synonyms: | ANTIPYRIN SALICYLATE;ANTIPYRINE SALICYLATE;SALIPYRINE;PHENAZONE SALICYLATE;ansal;salazolon;salicylicacidcompd.withantipyrine(1:1);saliphenazon |
| CAS: | 520-07-0 |
| EINECS: | 208-283-4 |
| Molecular Formula: | C11H12N2O . C7H6O3 |
| Molecular Weight: | 326.38 |
| InChI: | InChI=1/C11H12N2O.C7H6O3/c1-9-8-11(14)13(12(9)2)10-6-4-3-5-7-10;8-6-4-2-1-3-5(6)7(9)10/h3-8H,1-2H3;1-4,8H,(H,9,10) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 114.8°C |
| Boiling Point: | 319°Cat760mmHg |
| Density: | g/cm3 |
| Specification: |
Antipyrine salicylate (CAS NO.520-07-0) is also named as Ansal ; Phenazone salicylate ; Salazolon ; Saliphenazon ; Salipyrazolan ; Salipyrine ; Salicylic acid compd. with antipyrine (1:1) . Antipyrine salicylate (CAS NO.520-07-0) is moderate toxic. It is flammable. It will produce toxic nitrogen oxide fumes when buring. So the storage environment should be ventilate, low-temperature and dry. |
| Flash Point: | 114.8°C |
| Safety Data | |
 |
|
