| Identification | |
| Name: | 4-Acetamido-3-nitrobenzoic acid |
| Synonyms: | 4-Acetylamino-3-nitro-benzoic acid; |
| CAS: | 1539-06-6 |
| EINECS: | 216-265-2 |
| Molecular Formula: | C9H8N2O5 |
| Molecular Weight: | 224.17 |
| InChI: | InChI=1/C9H8N2O5/c1-5(12)10-7-3-2-6(9(13)14)4-8(7)11(15)16/h2-4H,1H3,(H,10,12)(H,13,14) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.526 g/cm3 |
| Appearance: | beige to yellow crystalline powder |
| Specification: | beige to yellow crystalline powder Safety Statements:36/37-37/39-26-36 36/37:Wear suitable protective clothing and gloves 37/39:Wear suitable protective clothing, gloves and eye/face protection 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
