| Identification | |
| Name: | 3-Methoxy-4-nitrobenzoic acid |
| Synonyms: | m-Anisicacid, 4-nitro- (6CI,7CI,8CI);4-Nitro-m-anisic acid;4-Nitro-3-methoxybenzoic acid; |
| CAS: | 5081-36-7 |
| EINECS: | 225-793-2 |
| Molecular Formula: | C8 H7 N O5 |
| Molecular Weight: | 197.15 |
| InChI: | InChI=1/C8H7NO5/c1-14-7-4-5(8(10)11)2-3-6(7)9(12)13/h2-4H,1H3,(H,10,11) |
| Molecular Structure: |  |
| Properties | |
| Transport: | Cool, dry,tightly closed |
| Flash Point: | 198.7 ºC |
| Boiling Point: | 404.9 ºC at 760 mmHg |
| Density: | 1.43 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Solubility: | Very soluble |
| Appearance: | Primrose yellow liquid |
| Specification: |
3-Methoxy-4-nitrobenzoic acid (CAS NO.5081-36-7), its Synonyms are 4-Nitro-3-methoxybenzoic acid ; 4-Nitro-m-anisic acid ; 3-Methoxy-4-nitrobenzoic acid, 98+% . It is light yellow to beige crystalline powder. |
| Flash Point: | 198.7 ºC |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
|
 |
|
