| Identification |
| Name: | 3-Methyl-4-nitrobenzoic acid |
| Synonyms: | 4-Nitro-m-toluic acid; 3-Methy-4-nitrobenzoatic Acid; 4-Nitro-3-Methyl benzoic acid |
| CAS: | 3113-71-1 |
| EINECS: | 221-479-4 |
| Molecular Formula: | C8H7NO4 |
| Molecular Weight: | 181.15 |
| InChI: | InChI=1/C8H7NO4/c1-5-4-6(8(10)11)2-3-7(5)9(12)13/h2-4H,1H3,(H,10,11) |
| Molecular Structure: |
 |
| Properties |
| Transport: | 50kgs |
| Flash Point: | 161.2oC |
| Boiling Point: | 356oC |
| Density: | 1.392 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Water Solubility: | AUTOIGNITION |
| Solubility: | AUTOIGNITION |
| Appearance: | yellowish to yellow crystalline powder |
| HS Code: | 29163900 |
| Flash Point: | 161.2oC |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
