| Identification | |
| Name: | 9-Fluorenylmethyl chloroformate |
| Synonyms: | 9-Fluorenylmethyloxycarbonylchloride; FMOC-chloride; Fmoc-Cl; Chloroformic acid 9-fluorenylmethyl ester; Fmoc-Cl; 9-Fluorenylmethoxycarbonyl |
| CAS: | 28920-43-6 |
| EINECS: | 249-313-6 |
| Molecular Formula: | C15H11ClO2 |
| Molecular Weight: | 258.69964 |
| InChI: | InChI=1S/C15H11ClO2/c16-15(17)18-9-14-12-7-3-1-5-10(12)11-6-2-4-8-13(11)14/h1-8,14H,9H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3261 8/PG 2 |
| Flash Point: | 393.9 ?C at 760 mmHg |
| Boiling Point: | 393.9 ?C at 760 mmHg |
| Density: | 1.288 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.611 |
| Water Solubility: | dioxane: 0.1 g/mL, clear, colorless |
| Solubility: | dioxane: 0.1 g/mL, clear, colorless |
| Appearance: | white to off-white powder |
| Specification: |
? 9-Fluorenylmethyl chloroformate (CAS NO.28920-43-6), its Synonyms are 1-(9-Fluorenyl)methyl chloroformate ; Carbonochloridic acid, 9H-fluoren-9-ylmethyl ester ; 9H-Fluoren-9-ylmethyl chloroformate ; Fluoren-9-ylmethyl chloroformate ; Formic acid, chloro-, fluoren-9-ylmethyl ester . It is white to off white crystalline powder. |
| Packinggroup: | II |
| HS Code: | 29159020 |
| Flash Point: | 393.9 ?C at 760 mmHg |
| Sensitive: | Moisture Sensitive |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
