| Identification | |
| Name: | Cloquinozine tartrate |
| Synonyms: | 2H-Quinolizine,3-[(4-chlorophenyl)methyl]- octahydro-,(2R,3R)-2,3-dihydroxybutanedioate (1:1);QB 1;3-(p-CHLOROBENZYL)QUINOLIZIDINE TARTRATE;3-(p-CHLOROBENZYL)OCTAHYDRO-QUINOLIZINE TARTRATE (1:1);QB-1; |
| CAS: | 34255-03-3 |
| Molecular Formula: | C16H22ClNC4H6O6 |
| Molecular Weight: | 413.89242 |
| InChI: | InChI=1S/C16H22ClN.C4H6O6/c17-15-7-4-13(5-8-15)11-14-6-9-16-3-1-2-10-18(16)12-14;5-1(3(7)8)2(6)4(9)10/h4-5,7-8,14,16H,1-3,6,9-12H2;1-2,5-6H,(H,7,8)(H,9,10)/t;1-,2-/m.1/s1 |
| Molecular Structure: | ![(C16H22ClNC4H6O6) 2H-Quinolizine,3-[(4-chlorophenyl)methyl]- octahydro-,(2R,3R)-2,3-dihydroxybutanedioate (1:1);QB 1;3...](https://img1.guidechem.com/structure/image/34255-03-3.png) |
| Properties | |
| Flash Point: | 170.8°C |
| Boiling Point: | 358.8°Cat760mmHg |
| Density: | g/cm3 |
| Specification: |
Cloquinozine tartrate , its cas register number is 34255-03-3. It also can be called 3-[(4-chlorophenyl)methyl]-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizine and (2R,3R)-2,3-dihydroxybutanedioic acid . When heated to decomposition it emits toxic fumes of Cl− and NOx. |
| Flash Point: | 170.8°C |
| Safety Data | |
 |
|
