| Identification |
| Name: | 1-Bromo-2,4-difluorobenzene |
| Synonyms: | 2,4-Difluorobromobenzene |
| CAS: | 348-57-2 |
| EINECS: | 206-479-4 |
| Molecular Formula: | C6H3BrF2 |
| Molecular Weight: | 192.99 |
| InChI: | InChI=1/C6H3BrF2/c7-5-2-1-4(8)3-6(5)9/h1-3H |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 1993 |
| Density: | 1.708 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.504-1.506 |
| Water Solubility: | INSOLUBLE |
| Solubility: | INSOLUBLE |
| Appearance: | Clear colorless to brown liquid |
| Packinggroup: | III |
| HS Code: | 29036990 |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
