Identification |
Name: | 1-Bromo-2,5-difluorobenzene |
Synonyms: | 1,4-Difluoro-2-bromobenzene; 2-BROMO-1,4-DIFLUOROBENZENE; 2,5-DIFLUOROBROMOBENZENE; 399-94-0; 1-Bromo-2,5-difluorobenzene 98%; 1-Bromo-2,5-difluorobenzene98%; 1-BROMO-2,5-DIFLUOROBENZENE 99.5% |
CAS: | 399-94-0 |
EINECS: | 206-920-0 |
Molecular Formula: | C6H3BrF2 |
Molecular Weight: | 192.99 |
InChI: | InChI=1/C6H3BrF2/c7-5-3-4(8)1-2-6(5)9/h1-3H |
Molecular Structure: |
|
Properties |
Transport: | UN 2922 |
Density: | 1.708 |
Stability: | Stable under normal temperatures and pressures. |
Refractive index: | 1.5075-1.5095 |
Water Solubility: | INSOLUBLE |
Solubility: | INSOLUBLE |
Appearance: | Clear, colorless liquid. |
Storage Temperature: | Keep away from sources of ignition. Store in a cool, dry place. Store in a tightly closed container. |
Safety Data |
Hazard Symbols |
Xi:Irritant
|
|
|