| Identification | |
| Name: | 1-Bromo-3,5-difluorobenzene |
| Synonyms: | 1-bromo-3,5-difluoro-benzene;3,5-Difluorobromobenzene;3,5-Difluoro-1-Bromobenzene;1-Bromo-3,5-Difluorobromobenzene;Benzene, 1-bromo-3,5-difluoro-;1,3-Difluoro-5-bromobenzene;3,5-Difluoro-Bromobenzene; |
| CAS: | 461-96-1 |
| EINECS: | 416-710-2 |
| Molecular Formula: | C6H3BrF2 |
| Molecular Weight: | 192.99 |
| InChI: | InChI=1/C6H3BrF2/c7-4-1-5(8)3-6(9)2-4/h1-3H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1993 |
| Density: | 1.676 |
| Refractive index: | 1.498-1.5 |
| Solubility: | 0.238 g/L (20 oC) |
| Appearance: | colorless clear liquid |
| Specification: |
? 1-Bromo-3,5-difluorobenzene ,?its cas register number is 461-96-1. It also can be called?Benzene, 1-bromo-3,5-difluoro ;?3,5-Difluorobromobenzene .?1-Bromo-3,5-difluorobenzene (CAS NO.461-96-1) is a clear colourless to light yellow liquid. |
| Packinggroup: | III |
| Storage Temperature: | Flammables area |
| Usage: | Intermediates of Liquid Crystals |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
