| Identification | |
| Name: | 1-Bromo-3,4-difluorobenzene |
| Synonyms: | Benzene, 4-bromo-1,2-difluoro-; 4-BROMO-1,2-DIFLUOROBENZENE; 3,4-DIFLUOROBROMOBENZENE; 3,4-Difluoro-1-Bromobenzene; 348-61-8; 1-Bromo-3,4-difluorobenzene 98%; 1-Bromo-3,4-difluorobenzene98%; 3,4-Difluoro Bromo Benzene |
| CAS: | 348-61-8 |
| EINECS: | 206-481-5 |
| Molecular Formula: | C6H3BrF2 |
| Molecular Weight: | 192.99 |
| InChI: | InChI=1/C6H3BrF2/c7-4-1-2-5(8)6(9)3-4/h1-3H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1993 |
| Density: | 1.707 |
| Stability: | No data. |
| Refractive index: | 1.504-1.506 |
| Water Solubility: | insoluble |
| Solubility: | insoluble |
| Appearance: | clear colorless to pale yellow liquid |
| Packinggroup: | III |
| Storage Temperature: | Flammables area |
| Usage: | Intermediates of Liquid Crystals |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
