| Identification | |
| Name: | 2,4-Difluoroaniline |
| Synonyms: | 2,4-Difluorobenzenamine; Difluoroaniline; 1-Amino-2,4-difluorobenzene |
| CAS: | 367-25-9 |
| EINECS: | 206-687-5 |
| Molecular Formula: | C6H5F2N |
| Molecular Weight: | 129.11 |
| InChI: | InChI=1/C6H5F2N/c7-4-1-2-6(9)5(8)3-4/h1-3H,9H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 230kgs |
| Density: | 1.268 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents, acids, acid chlorides, acid anhydrides. |
| Refractive index: | 1.5025-1.5075 |
| Solubility: | Insoluble |
| Appearance: | clear liquid |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| HS Code: | 29214210 |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Usage: | Substance is used in organic syntheses. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
