| Identification |
| Name: | 2,5-Difluoroaniline |
| Synonyms: | 2,5-Difluorobenzenamine; 2,5-Difluoroaniline,98%; 2,5-Difluoro Benzene; Difluoroaniline3; 2,5-Difluoro Aniline; 2,5-Difluoroaniline |
| CAS: | 367-30-6 |
| EINECS: | 206-690-1 |
| Molecular Formula: | C6H5F2N |
| Molecular Weight: | 129.11 |
| InChI: | InChI=1/C6H5F2N/c7-4-1-2-5(8)6(9)3-4/h1-3H,9H2 |
| Molecular Structure: |
 |
| Properties |
| Transport: | 230kgs |
| Density: | 1.288 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.512-1.514 |
| Water Solubility: | Insoluble |
| Solubility: | Insoluble |
| Appearance: | clear liquid |
| Packinggroup: | III |
| HS Code: | 29214210 |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| Hazard Symbols |
Xn:Harmful
|
| |
 |
