| Identification | |
| Name: | 3,5-Difluoroaniline |
| Synonyms: | 3,5-Difluorobenzenamine |
| CAS: | 372-39-4 |
| EINECS: | 206-752-8 |
| Molecular Formula: | C6H5F2N |
| Molecular Weight: | 129.11 |
| InChI: | InChI=1/C6H5F2N/c7-4-1-5(8)3-6(9)2-4/h1-3H,9H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1325 |
| Density: | 1.289 g/cm3 |
| Stability: | No data. |
| Refractive index: | 1,512-1,514 |
| Solubility: | Slightly soluble |
| Appearance: | White Crystal |
| Packinggroup: | III |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
