| Identification | |
| Name: | Spaglumic acid |
| Synonyms: | Glutamicacid, N-(N-acetyl-L-b-aspartyl)- (7CI); Glutamic acid, N-(N-acetyl-L-b-aspartyl)-, L- (8CI); L-Glutamicacid, N-(N-acetyl-L-b-aspartyl)-; L-Glutamic acid,N-acetyl-L-b-aspartyl-; b-NAAG; b-Spaglumicacid |
| CAS: | 4910-46-7 |
| Molecular Formula: | C11H16 N2 O8 |
| Molecular Weight: | 304.25 |
| InChI: | InChI=1/C11H16N2O8/c1-5(14)12-7(4-9(17)18)10(19)13-6(11(20)21)2-3-8(15)16/h6-7H,2-4H2,1H3,(H,12,14)(H,13,19)(H,15,16)(H,17,18)(H,20,21)/p-3/t6-,7-/m0/s1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 419.1°C |
| Boiling Point: | 769.5°Cat760mmHg |
| Density: | 1.472g/cm3 |
| Specification: | Safety Statements:22-24/25 22:Do not breathe dust 24/25:Avoid contact with skin and eyes |
| Biological Activity: | The most abundant peptide neurotransmitter in the mammalian CNS. A weak activator of NMDA receptors, and a highly selective agonist for mGlu 3 receptors. Neuroprotective under non-hydrolysing conditions in vivo . |
| Flash Point: | 419.1°C |
| Storage Temperature: | −20°C |
| Safety Data | |
 |
|
