| Identification | |
| Name: | Benzoic acid |
| Synonyms: | Melting point standard benzoic acid; Benzoic-12C7 acid, 13C-depleted; Benzoic acid, USP Grade; 4-Carboxypolystyrene |
| CAS: | 65-85-0 |
| EINECS: | 200-618-2 |
| Molecular Formula: | C7H6O2 |
| Molecular Weight: | 122.12 |
| InChI: | InChI=1/C7H6O2/c8-7(9)6-4-2-1-3-5-6/h1-5H,(H,8,9) |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 9094 |
| Density: | 1.08 |
| Stability: | Stable. Combustible. Incompatible with strong bases, strong oxidizing agents, alkalies. |
| Refractive index: | 1.504 |
| Water Solubility: | Slightly soluble. 0.34 g/100 mL |
| Solubility: | Slightly soluble. 0.34 g/100 mL in water |
| Appearance: | white crystals or powder |
| Specification: |
Benzoic acid , its cas register number is 65-85-0. It also can be called Benzenecarboxylic acid ; Benzeneformic acid ; Benzenemethonic acid ; Carboxybenzene ; Oracylic acid ; phenyl carboxylic acid ; Phenylformic acid .It is a white crystals or powder and slightly soluble in water. At high temperature it can react with oxidizing reagents.Dust may be irritating to nose and eyes. At elevated temperatures, fumes may cause irritation of eyes, respiratory system, and skin. |
| Packinggroup: | Z01 |
| Storage Temperature: | Store at RT. |
| Color: | Monoclinic tablets, plates, leaflets White scales or needle crystals |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
