| Identification | |
| Name: | Syringic acid |
| Synonyms: | 4-Hydroxy-3,5-dimethoxybenzoic acid; Syringic acid(4-Hydroxy 3,5-dimethoxybenzoic acid); Suringic acid; 3,5-Dimethoxy-4-hydroxybenzoic acid; 3,5-Dimethoxy-4-hydroxy-benzoic acid |
| CAS: | 530-57-4 |
| EINECS: | 208-486-8 |
| Molecular Formula: | C9H10O5 |
| Molecular Weight: | 198.17 |
| InChI: | InChI=1/C9H10O5/c1-13-6-3-5(9(11)12)4-7(14-2)8(6)10/h3-4,10H,1-2H3,(H,11,12) |
| Molecular Structure: |  |
| Properties | |
| Transport: | HAZARD |
| Density: | 1.335g/cm3 |
| Stability: | Stable. Incompatible with strong bases, strong oxidizing agents. |
| Refractive index: | 1.566 |
| Solubility: | Insoluble |
| Appearance: | white to off-white crystalline powder |
| Specification: |
Syringic acid , its CAS NO. is 530-57-4, the synonyms are 3,5-Dimethoxy-4-hydroxybenzoic acid 3,5-Dimethoxy-4-hydroxybenzyl acid ; 4-Hydroxy-3,5-dimethoxybenzoic acid ; Gallic acid 3,5-dimethyl ether ; Benzoic acid, 4-hydroxy-3,5-dimethoxy- . |
| Report: |
Reported in EPA TSCA Inventory. |
| HS Code: | 29189090 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Usage: | Inhibitor of poly(ethylene glycol) oxidation. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
