| Identification | |
| Name: | 2-Nitrobenzoic Acid |
| Synonyms: | Benzoicacid, o-nitro- (8CI); 2-Nitrobenzoic acid; NSC 9576; o-Carboxynitrobenzene;o-Nitrobenzoic acid |
| CAS: | 552-16-9 |
| EINECS: | 209-004-9 |
| Molecular Formula: | C7H5NO4 |
| Molecular Weight: | 167.12 |
| InChI: | InChI=1/C7H5NO4/c9-7(10)5-3-1-2-4-6(5)8(11)12/h1-4H,(H,9,10) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 157.5°C |
| Boiling Point: | 340.7°Cat760mmHg |
| Density: | 1.468g/cm3 |
| Stability: | Stable. Incompatible with strong oxidizing agents, strong bases. |
| Water Solubility: | 6.8 g/L |
| Solubility: | 6.8 g/L |
| Appearance: | off-white powder |
| Specification: |
2-Nitrobenzoic Acid (CAS NO.552-16-9) is also called AI3-08821 ; CCRIS 2334 ; o-Carboxynitrobenzene ; o-Nitrobenzoic acid ; Benzoic acid, 2-nitro- ; Benzoic acid, o-nitro- ; o-Nitrobenzoic acid . 2-Nitrobenzoic Acid (CAS NO.552-16-9) is soluble in ethanol, ethyl ether, acetone, methanol, soluble in water and chloroform, very slightly soluble in benzene and carbon disulfide. 2-Nitrobenzoic acid is incompatible with strong oxidizing agents. Also incompatible with strong bases. May react with cyanides. When 2-Nitrobenzoic acid is heated to decomposition it emits very toxic fumes. Flash point data concerning 2-Nitrobenzoic acid are not available, however, 2-Nitrobenzoic acid is probably combustible. |
| Packinggroup: | Z01 |
| HS Code: | 29163900 |
| Flash Point: | 157.5°C |
| Storage Temperature: | Store at RT. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
