| Identification |
| Name: | 7-Hydroxyquinoline |
| Synonyms: | NSC 87630;Quinolin-7-ol; |
| CAS: | 580-20-1 |
| EINECS: | 209-457-2 |
| Molecular Formula: | C9H7NO |
| Molecular Weight: | 145.16 |
| InChI: | InChI=1/C9H7NO/c11-8-4-3-7-2-1-5-10-9(7)6-8/h1-6,11H |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 143.1 oC |
| Boiling Point: | 313 oC at 760 mmHg |
| Density: | 1.26 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.642 |
| Solubility: | Slightly soluble |
| Appearance: | white to light yellow crystal powder |
| Flash Point: | 143.1 oC |
| Storage Temperature: | Store in a cool, dry place. Keep container closed when not in use. |
| Safety Data |
| Hazard Symbols |
Xn:Harmful
|
| |
 |
