| Identification | |
| Name: | Acetamide |
| Synonyms: | Acetic acid amide; Acetimidic Acid; Ethanamide; Methanecarboxamide; |
| CAS: | 60-35-5 |
| EINECS: | 200-473-5 |
| Molecular Formula: | C2H5NO |
| Molecular Weight: | 59.07 |
| InChI: | InChI=1/C2H5NO/c1-2(3)4/h1H3,(H2,3,4) |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3077 |
| Density: | 1.159 |
| Stability: | Stable. Incompatible with strong acids, strong oxidizing agents, strong bases. Deliquescent. Triboluminescent. |
| Refractive index: | 1.392 |
| Solubility: | Soluble (decomposes in hot water; SOLVENT |
| Appearance: | white crystalline solid |
| Specification: | colourless deliquescent crystals Safety Statements:36/37 36/37:Wear suitable protective clothing and gloves |
| HS Code: | 29241900 |
| Storage Temperature: | Store at RT |
| Color: | Deliquescent hexagonal crystals TRIGONAL MONOCLINIC CRYSTALS |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
