| Identification |
| Name: | Benzene,1-iodo-2-methyl- |
| Synonyms: | Toluene,o-iodo- (7CI,8CI);1-Iodo-2-methylbenzene;2-Methyl-1-iodobenzene;2-Methyliodobenzene;2-Methylphenyl iodide;2-Tolyliodide;NSC 3774;o-Iodotoluene;o-Methyliodobenzene;o-Methylphenyl iodide;o-Tolyl iodide; |
| CAS: | 615-37-2 |
| EINECS: | 210-422-9 |
| Molecular Formula: | C7H7I |
| Molecular Weight: | 218.03495 |
| InChI: | InChI=1S/C7H7I/c1-6-4-2-3-5-7(6)8/h2-5H,1H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 2810 |
| Density: | 1.713 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.608-1.61 |
| Appearance: | clear yellow liquid |
| HS Code: | 29036990 |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Sensitive: | Light Sensitive |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
