| Identification | |
| Name: | Sodium edetate |
| Synonyms: | Aceticacid, (ethylenedinitrilo)tetra-, tetrasodium salt (8CI);Warkeelate PS 47;tetrasodium versenate;(Ethylenedinitrilo)tetraacetic acid tetrasodium salt (EDTA 4NA);(Ethylenedinitrilo)tetraacetic acid tetrasodium salt;Aquamollin BC;Celon E;Celon H;Cheelox BF;Chelest 400;Chelon 100;Chemcolox 240Powder;Clewat T;Dissolvine E 39;Dissolvine NA;Distol;Dotite 4NA;EDTA tetrasodium salt; |
| CAS: | 64-02-8 |
| EINECS: | 200-573-9 |
| Molecular Formula: | C10H12N2Na4O8 |
| Molecular Weight: | 380.16996 |
| InChI: | InChI=1S/C10H16N2O8.4Na/c13-7(14)3-11(4-8(15)16)1-2-12(5-9(17)18)6-10(19)20;;;;/h1-6H2,(H,13,14)(H,15,16)(H,17,18)(H,19,20);;;;/q;4*+1/p-4 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 25kgs |
| Melting Point: | >300oC |
| Flash Point: | Not considered to be a fire hazard |
| Boiling Point: | Decomposes (> 400 C) |
| Density: | 6.9 g/cm3 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Water Solubility: | Soluble |
| Solubility: | Soluble |
| Appearance: | white creamy powder |
| Specification: | white powder Safety Statements:26-36/37-37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37:Wear suitable protective clothing and gloves 37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | Not considered to be a fire hazard |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Color: | White powder |
| Usage: | Medication. |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
