| Identification | |
| Name: | Ethanephosphonic acid |
| Synonyms: | Ethylphosphonic acid |
| CAS: | 6779-09-5 |
| EINECS: | 229-839-2 |
| Molecular Formula: | C2H7O3P |
| Molecular Weight: | 109.041001 |
| InChI: | InChI=1S/C2H5O3P/c1-2-5-6(3)4/h2H2,1H3/p+1 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3261 8/PG 2 |
| Melting Point: | 61-63 °C(lit.) |
| Flash Point: | 111.3°C |
| Boiling Point: | 260.5°C at 760 mmHg |
| Stability: | Stable. Incompatible with strong oxidizing agents, strong bases. |
| Water Solubility: | Stability Stable. Incompatible with strong oxidizing agents, strong bases. Toxicology Corrosive - causes burns. Very destructive of mucous membranes.Harmful if inhaled or swallowed. |
| Solubility: |
|
| Appearance: | white crystalline powder |
| Specification: | white crystalline powder Safety Statements:26-27-28-36/37/39-45 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 27:Take off immediately all contaminated clothing 28:After contact with skin, wash immediately with plenty of ... (to be specified by the manufacturer) 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) |
| Packinggroup: | III |
| Flash Point: | 111.3°C |
| Sensitive: | Moisture Sensitive |
| Safety Data | |
 |
|
