| Identification | |
| Name: | Phenol,2-(1,3-dioxolan-2-yl)-, 1-(N-methylcarbamate) |
| Synonyms: | Carbamicacid, methyl-, o-1,3-dioxolan-2-ylphenyl ester (7CI,8CI); Phenol,2-(1,3-dioxolan-2-yl)-, methylcarbamate (9CI); 2-(1,3-Dioxolan-2-yl)phenylN-methylcarbamate; 2-(1,3-Dioxolan-2-yl)phenyl methylcarbamate;2-(1,3-Dioxolane-2-yl)-phenyl N-methylcarbamate; C 8353; CIBA 8353; CIBA C8353; Dioxacarb; Du Pont 1519; Elocron; Elocron 50WP; Elocron 8353; Famid;MCDP; Rovlinka; o-(1,3-Dioxolan-2-yl)phenyl methylcarbamate |
| CAS: | 6988-21-2 |
| EINECS: | 230-253-4 |
| Molecular Formula: | C11H13 N O4 |
| Molecular Weight: | 223.25 |
| InChI: | InChI=1/C11H13NO4/c1-12-11(13)16-9-5-3-2-4-8(9)10-14-6-7-15-10/h2-5,10H,6-7H2,1H3,(H,12,13) |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2757 |
| Flash Point: | 147.5°C |
| Boiling Point: | 320.3°C at 760 mmHg |
| Density: | 1.23g/cm3 |
| Refractive index: | 1.534 |
| Specification: | usageEng:Dioxacarb is used as pesticide. Safety Statements:37-45-61 37:Wear suitable gloves 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) 61:Avoid release to the environment. Refer to special instructions safety data sheet |
| Packinggroup: | III |
| Flash Point: | 147.5°C |
| Storage Temperature: | 0-6°C |
| Usage: | Dioxacarb is used as pesticide. |
| Safety Data | |
 |
|
