| Identification | |
| Name: | Nitroiminodiethylenediisocyanic acid |
| Synonyms: | (Nitroimino)diethylenediisocyanate |
| CAS: | 7046-61-9 |
| Molecular Formula: | C6H8N4O4 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C6H8N4O4/c11-5-7-1-3-9(10(13)14)4-2-8-6-12/h1-4H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 183.9°C |
| Boiling Point: | 380.5°C at 760 mmHg |
| Density: | 1.34g/cm3 |
| Refractive index: | 1.55 |
| Specification: |
Nitroiminodiethylenediisocyanic acid , its cas register number is 7046-61-9. It also can be called Isocyanic acid, (nitroimino)diethylene ester ; Ethanamine, 2-isocyanato-N-(2-isocyanatoethyl)-N-nitro- ; and 3-Nitro-3-azapentane-1,5-diisocyanate . |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 183.9°C |
| Safety Data | |
 |
|
