| Identification | |
| Name: | Salicylhydroxamic acid |
| Synonyms: | 2-Hydroxybenzohydroxamic acid; salicylohydroxamic acid; N,2-dihydroxybenzenecarboximidic acid ; N,2-Dihydroxybenzamide |
| CAS: | 89-73-6 |
| EINECS: | 201-934-3 |
| Molecular Formula: | C7H7NO3 |
| Molecular Weight: | 153.13538 |
| InChI: | InChI=1S/C7H7NO3/c9-6-4-2-1-3-5(6)7(10)8-11/h1-4,9,11H,(H,8,10) |
| Molecular Structure: |  |
| Properties | |
| Transport: | OTH |
| Flash Point: | 248.9°C |
| Boiling Point: | Sublimes |
| Density: | 1.402g/cm3 |
| Stability: | Stable. Incompatible with strong bases, strong oxidizing agents. Combustible. |
| Refractive index: | 1.626 |
| Water Solubility: | soluble |
| Solubility: | soluble |
| Appearance: | brownish crystalline powder |
| Specification: |
Salicylhydroxamic acid (89-73-6) also can be called SHAM ; Salicylhydroxamate ; Saliaylhydroxamic acid ; 2-Hydroxybenzohydroxamic acid and Benzamide, N,2-dihydroxy- . |
| Report: |
EPA Genetic Toxicology Program. |
| Flash Point: | 248.9°C |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Usage: | Complexing agent. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
